C8H11N3O2S — CID 163225694
[(E)-[amino-[5-(aminomethyl)thiophen-3-yl]methylidene]amino] acetate (PubChem CID 163225694) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is [(E)-[amino-[5-(aminomethyl)thiophen-3-yl]methylidene]amino] acetate.
| Compound Name | [(E)-[amino-[5-(aminomethyl)thiophen-3-yl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 163225694 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | [(E)-[amino-[5-(aminomethyl)thiophen-3-yl]methylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(/N)c1csc(CN)c1 |
| InChI | InChI=1S/C8H11N3O2S/c1-5(12)13-11-8(10)6-2-7(3-9)14-4-6/h2,4H,3,9H2,1H3,(H2,10,11) |
| InChIKey | DKHHUWAINHKGGK-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|