C11H15N3O5S — CID 174056647
[1-[4-(N'-acetyloxycarbamimidoyl)thiophen-2-yl]-2-methoxyethyl]carbamic acid (PubChem CID 174056647) has the molecular formula C11H15N3O5S and a molecular weight of 301.32 g/mol. Its IUPAC name is [1-[4-(N'-acetyloxycarbamimidoyl)thiophen-2-yl]-2-methoxyethyl]carbamic acid.
| Compound Name | [1-[4-(N'-acetyloxycarbamimidoyl)thiophen-2-yl]-2-methoxyethyl]carbamic acid |
|---|---|
| PubChem CID | 174056647 |
| Molecular Formula | C11H15N3O5S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | [1-[4-(N'-acetyloxycarbamimidoyl)thiophen-2-yl]-2-methoxyethyl]carbamic acid |
| SMILES | COCC(NC(=O)O)c1cc(C(N)=NOC(C)=O)cs1 |
| InChI | InChI=1S/C11H15N3O5S/c1-6(15)19-14-10(12)7-3-9(20-5-7)8(4-18-2)13-11(16)17/h3,5,8,13H,4H2,1-2H3,(H2,12,14)(H,16,17) |
| InChIKey | UNPHVUIXXVUGDZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|