C8H10N4O4S — CID 174056758
[2-amino-1-[4-(N'-hydroxycarbamimidoyl)thiophen-2-yl]-2-oxoethyl]carbamic acid (PubChem CID 174056758) has the molecular formula C8H10N4O4S and a molecular weight of 258.26 g/mol. Its IUPAC name is [2-amino-1-[4-(N'-hydroxycarbamimidoyl)thiophen-2-yl]-2-oxoethyl]carbamic acid.
| Compound Name | [2-amino-1-[4-(N'-hydroxycarbamimidoyl)thiophen-2-yl]-2-oxoethyl]carbamic acid |
|---|---|
| PubChem CID | 174056758 |
| Molecular Formula | C8H10N4O4S |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | [2-amino-1-[4-(N'-hydroxycarbamimidoyl)thiophen-2-yl]-2-oxoethyl]carbamic acid |
| SMILES | NC(=O)C(NC(=O)O)c1cc(C(N)=NO)cs1 |
| InChI | InChI=1S/C8H10N4O4S/c9-6(12-16)3-1-4(17-2-3)5(7(10)13)11-8(14)15/h1-2,5,11,16H,(H2,9,12)(H2,10,13)(H,14,15) |
| InChIKey | RJLOKPZLVBTESO-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 151.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|