C14H13N3O3S — CID 94480093
2-N-[(1S)-2-amino-2-oxo-1-phenylethyl]thiophene-2,4-dicarboxamide (PubChem CID 94480093) has the molecular formula C14H13N3O3S and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-N-[(1S)-2-amino-2-oxo-1-phenylethyl]thiophene-2,4-dicarboxamide.
| Compound Name | 2-N-[(1S)-2-amino-2-oxo-1-phenylethyl]thiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 94480093 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-N-[(1S)-2-amino-2-oxo-1-phenylethyl]thiophene-2,4-dicarboxamide |
| SMILES | NC(=O)c1csc(C(=O)N[C@H](C(N)=O)c2ccccc2)c1 |
| InChI | InChI=1S/C14H13N3O3S/c15-12(18)9-6-10(21-7-9)14(20)17-11(13(16)19)8-4-2-1-3-5-8/h1-7,11H,(H2,15,18)(H2,16,19)(H,17,20)/t11-/m0/s1 |
| InChIKey | SSGCYMRBCVYXPC-NSHDSACASA-N |
| XLogP | 0.80 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |