C15H13F3N2O2S — CID 86829165
2-N-[1-[4-(trifluoromethyl)phenyl]ethyl]thiophene-2,4-dicarboxamide (PubChem CID 86829165) has the molecular formula C15H13F3N2O2S and a molecular weight of 342.34 g/mol. Its IUPAC name is 2-N-[1-[4-(trifluoromethyl)phenyl]ethyl]thiophene-2,4-dicarboxamide.
| Compound Name | 2-N-[1-[4-(trifluoromethyl)phenyl]ethyl]thiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 86829165 |
| Molecular Formula | C15H13F3N2O2S |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-N-[1-[4-(trifluoromethyl)phenyl]ethyl]thiophene-2,4-dicarboxamide |
| SMILES | CC(NC(=O)c1cc(C(N)=O)cs1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H13F3N2O2S/c1-8(9-2-4-11(5-3-9)15(16,17)18)20-14(22)12-6-10(7-23-12)13(19)21/h2-8H,1H3,(H2,19,21)(H,20,22) |
| InChIKey | ZQYFBTMAKCVJME-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |