C16H15FN2O2S — CID 95616963
2-N-[(S)-cyclopropyl-(4-fluorophenyl)methyl]thiophene-2,4-dicarboxamide (PubChem CID 95616963) has the molecular formula C16H15FN2O2S and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-N-[(S)-cyclopropyl-(4-fluorophenyl)methyl]thiophene-2,4-dicarboxamide.
| Compound Name | 2-N-[(S)-cyclopropyl-(4-fluorophenyl)methyl]thiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 95616963 |
| Molecular Formula | C16H15FN2O2S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-N-[(S)-cyclopropyl-(4-fluorophenyl)methyl]thiophene-2,4-dicarboxamide |
| SMILES | NC(=O)c1csc(C(=O)N[C@H](c2ccc(F)cc2)C2CC2)c1 |
| InChI | InChI=1S/C16H15FN2O2S/c17-12-5-3-10(4-6-12)14(9-1-2-9)19-16(21)13-7-11(8-22-13)15(18)20/h3-9,14H,1-2H2,(H2,18,20)(H,19,21)/t14-/m0/s1 |
| InChIKey | GPRPENKTSHFDML-AWEZNQCLSA-N |
| XLogP | 2.87 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |