C16H17NOS — CID 51296320
N-[cyclopropyl-(4-methylphenyl)methyl]thiophene-2-carboxamide (PubChem CID 51296320) has the molecular formula C16H17NOS and a molecular weight of 271.38 g/mol. Its IUPAC name is N-[cyclopropyl-(4-methylphenyl)methyl]thiophene-2-carboxamide.
| Compound Name | N-[cyclopropyl-(4-methylphenyl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 51296320 |
| Molecular Formula | C16H17NOS |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-[cyclopropyl-(4-methylphenyl)methyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(C(NC(=O)c2cccs2)C2CC2)cc1 |
| InChI | InChI=1S/C16H17NOS/c1-11-4-6-12(7-5-11)15(13-8-9-13)17-16(18)14-3-2-10-19-14/h2-7,10,13,15H,8-9H2,1H3,(H,17,18) |
| InChIKey | SDYMVHPROXYJQH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |