C19H21BrN2O2S — CID 55978681
N-[1-[[(4-bromophenyl)-cyclobutylmethyl]amino]-1-oxopropan-2-yl]thiophene-2-carboxamide (PubChem CID 55978681) has the molecular formula C19H21BrN2O2S and a molecular weight of 421.36 g/mol. Its IUPAC name is N-[1-[[(4-bromophenyl)-cyclobutylmethyl]amino]-1-oxopropan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-[[(4-bromophenyl)-cyclobutylmethyl]amino]-1-oxopropan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55978681 |
| Molecular Formula | C19H21BrN2O2S |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | N-[1-[[(4-bromophenyl)-cyclobutylmethyl]amino]-1-oxopropan-2-yl]thiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1cccs1)C(=O)NC(c1ccc(Br)cc1)C1CCC1 |
| InChI | InChI=1S/C19H21BrN2O2S/c1-12(21-19(24)16-6-3-11-25-16)18(23)22-17(13-4-2-5-13)14-7-9-15(20)10-8-14/h3,6-13,17H,2,4-5H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | XNRAORDWZDLCOR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |