C17H19BrN2O2S — CID 51299263
N-[1-[1-(4-bromophenyl)propylamino]-1-oxopropan-2-yl]thiophene-2-carboxamide (PubChem CID 51299263) has the molecular formula C17H19BrN2O2S and a molecular weight of 395.32 g/mol. Its IUPAC name is N-[1-[1-(4-bromophenyl)propylamino]-1-oxopropan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-[1-(4-bromophenyl)propylamino]-1-oxopropan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 51299263 |
| Molecular Formula | C17H19BrN2O2S |
| Molecular Weight | 395.32 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | N-[1-[1-(4-bromophenyl)propylamino]-1-oxopropan-2-yl]thiophene-2-carboxamide |
| SMILES | CCC(NC(=O)C(C)NC(=O)c1cccs1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H19BrN2O2S/c1-3-14(12-6-8-13(18)9-7-12)20-16(21)11(2)19-17(22)15-5-4-10-23-15/h4-11,14H,3H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | DSYLEOCUXKBXIP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |