C17H18N2O2S — CID 95979886
2-N-[(S)-cyclopropyl-(2-methylphenyl)methyl]thiophene-2,4-dicarboxamide (PubChem CID 95979886) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-N-[(S)-cyclopropyl-(2-methylphenyl)methyl]thiophene-2,4-dicarboxamide.
| Compound Name | 2-N-[(S)-cyclopropyl-(2-methylphenyl)methyl]thiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 95979886 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2-N-[(S)-cyclopropyl-(2-methylphenyl)methyl]thiophene-2,4-dicarboxamide |
| SMILES | Cc1ccccc1[C@@H](NC(=O)c1cc(C(N)=O)cs1)C1CC1 |
| InChI | InChI=1S/C17H18N2O2S/c1-10-4-2-3-5-13(10)15(11-6-7-11)19-17(21)14-8-12(9-22-14)16(18)20/h2-5,8-9,11,15H,6-7H2,1H3,(H2,18,20)(H,19,21)/t15-/m0/s1 |
| InChIKey | KSUOIUUXYWUMEB-HNNXBMFYSA-N |
| XLogP | 3.04 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |