About 2-N-[(S)-cyclopropyl-(2-methylphenyl)methyl]thiophene-2,4-dicarboxamide
2-N-[(S)-cyclopropyl-(2-methylphenyl)methyl]thiophene-2,4-dicarboxamide (PubChem CID 95979886) has the molecular formula C17H18N2O2S
and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-N-[(S)-cyclopropyl-(2-methylphenyl)methyl]thiophene-2,4-dicarboxamide.
Molecular Properties
| Compound Name | 2-N-[(S)-cyclopropyl-(2-methylphenyl)methyl]thiophene-2,4-dicarboxamide |
| PubChem CID | 95979886 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2-N-[(S)-cyclopropyl-(2-methylphenyl)methyl]thiophene-2,4-dicarboxamide |
| SMILES | Cc1ccccc1[C@@H](NC(=O)c1cc(C(N)=O)cs1)C1CC1 |
| InChI | InChI=1S/C17H18N2O2S/c1-10-4-2-3-5-13(10)15(11-6-7-11)19-17(21)14-8-12(9-22-14)16(18)20/h2-5,8-9,11,15H,6-7H2,1H3,(H2,18,20)(H,19,21)/t15-/m0/s1 |
| InChIKey | KSUOIUUXYWUMEB-HNNXBMFYSA-N |
| XLogP | 3.04 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-[(S)-cyclopropyl-(2-methylphenyl)methyl]thiophene-2,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[(S)-cyclopropyl-(2-methylphenyl)methyl]thiophene-2,4-dicarboxamide?
The IUPAC name of 2-N-[(S)-cyclopropyl-(2-methylphenyl)methyl]thiophene-2,4-dicarboxamide (CID 95979886) is 2-N-[(S)-cyclopropyl-(2-methylphenyl)methyl]thiophene-2,4-dicarboxamide.
What is the SMILES notation for 2-N-[(S)-cyclopropyl-(2-methylphenyl)methyl]thiophene-2,4-dicarboxamide?
The canonical SMILES for 2-N-[(S)-cyclopropyl-(2-methylphenyl)methyl]thiophene-2,4-dicarboxamide is Cc1ccccc1[C@@H](NC(=O)c1cc(C(N)=O)cs1)C1CC1.
What is the InChIKey of 2-N-[(S)-cyclopropyl-(2-methylphenyl)methyl]thiophene-2,4-dicarboxamide?
The InChIKey is KSUOIUUXYWUMEB-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H18N2O2S/c1-10-4-2-3-5-13(10)15(11-6-7-11)19-17(21)14-8-12(9-22-14)16(18)20/h2-5,8-9,11,15H,6-7H2,1H3,(H2,18,20)(H,19,21)/t15-/m0/s1.
What are the key properties of 2-N-[(S)-cyclopropyl-(2-methylphenyl)methyl]thiophene-2,4-dicarboxamide?
2-N-[(S)-cyclopropyl-(2-methylphenyl)methyl]thiophene-2,4-dicarboxamide has a molecular weight of 314.41 g/mol, XLogP of 3.04, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[(S)-cyclopropyl-(2-methylphenyl)methyl]thiophene-2,4-dicarboxamide is sourced from PubChem (CID 95979886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).