C17H18N2O2 — CID 51175514
4-N-[1-(2-methylphenyl)ethyl]benzene-1,4-dicarboxamide (PubChem CID 51175514) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-N-[1-(2-methylphenyl)ethyl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[1-(2-methylphenyl)ethyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 51175514 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 4-N-[1-(2-methylphenyl)ethyl]benzene-1,4-dicarboxamide |
| SMILES | Cc1ccccc1C(C)NC(=O)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C17H18N2O2/c1-11-5-3-4-6-15(11)12(2)19-17(21)14-9-7-13(8-10-14)16(18)20/h3-10,12H,1-2H3,(H2,18,20)(H,19,21) |
| InChIKey | LZVWEBLQRIGQGQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |