C17H18ClNO — CID 81375390
4-(chloromethyl)-N-[(1S)-1-(2-methylphenyl)ethyl]benzamide (PubChem CID 81375390) has the molecular formula C17H18ClNO and a molecular weight of 287.79 g/mol. Its IUPAC name is 4-(chloromethyl)-N-[(1S)-1-(2-methylphenyl)ethyl]benzamide.
| Compound Name | 4-(chloromethyl)-N-[(1S)-1-(2-methylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 81375390 |
| Molecular Formula | C17H18ClNO |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 4-(chloromethyl)-N-[(1S)-1-(2-methylphenyl)ethyl]benzamide |
| SMILES | Cc1ccccc1[C@H](C)NC(=O)c1ccc(CCl)cc1 |
| InChI | InChI=1S/C17H18ClNO/c1-12-5-3-4-6-16(12)13(2)19-17(20)15-9-7-14(11-18)8-10-15/h3-10,13H,11H2,1-2H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | OYUJHTILHFRFAO-ZDUSSCGKSA-N |
| XLogP | 4.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|