C16H16N2O3S — CID 136587051
2-N-[(1S,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]thiophene-2,4-dicarboxamide (PubChem CID 136587051) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-N-[(1S,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]thiophene-2,4-dicarboxamide.
| Compound Name | 2-N-[(1S,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]thiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 136587051 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2-N-[(1S,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]thiophene-2,4-dicarboxamide |
| SMILES | NC(=O)c1csc(C(=O)N[C@H]2c3ccccc3CC[C@H]2O)c1 |
| InChI | InChI=1S/C16H16N2O3S/c17-15(20)10-7-13(22-8-10)16(21)18-14-11-4-2-1-3-9(11)5-6-12(14)19/h1-4,7-8,12,14,19H,5-6H2,(H2,17,20)(H,18,21)/t12-,14+/m1/s1 |
| InChIKey | NFCKNNGACCWMPM-OCCSQVGLSA-N |
| XLogP | 1.63 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |