C15H12Cl2N2O3S — CID 139009293
2-N-(7,8-dichloro-3,4-dihydro-2H-chromen-4-yl)thiophene-2,4-dicarboxamide (PubChem CID 139009293) has the molecular formula C15H12Cl2N2O3S and a molecular weight of 371.25 g/mol. Its IUPAC name is 2-N-(7,8-dichloro-3,4-dihydro-2H-chromen-4-yl)thiophene-2,4-dicarboxamide.
| Compound Name | 2-N-(7,8-dichloro-3,4-dihydro-2H-chromen-4-yl)thiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 139009293 |
| Molecular Formula | C15H12Cl2N2O3S |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 2-N-(7,8-dichloro-3,4-dihydro-2H-chromen-4-yl)thiophene-2,4-dicarboxamide |
| SMILES | NC(=O)c1csc(C(=O)NC2CCOc3c2ccc(Cl)c3Cl)c1 |
| InChI | InChI=1S/C15H12Cl2N2O3S/c16-9-2-1-8-10(3-4-22-13(8)12(9)17)19-15(21)11-5-7(6-23-11)14(18)20/h1-2,5-6,10H,3-4H2,(H2,18,20)(H,19,21) |
| InChIKey | WQSPBIIRWBAQHZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |