C16H12ClN3O6 — CID 60572063
N-(8-chloro-3,4-dihydro-2H-chromen-4-yl)-3,5-dinitrobenzamide (PubChem CID 60572063) has the molecular formula C16H12ClN3O6 and a molecular weight of 377.74 g/mol. Its IUPAC name is N-(8-chloro-3,4-dihydro-2H-chromen-4-yl)-3,5-dinitrobenzamide.
| Compound Name | N-(8-chloro-3,4-dihydro-2H-chromen-4-yl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 60572063 |
| Molecular Formula | C16H12ClN3O6 |
| Molecular Weight | 377.74 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | N-(8-chloro-3,4-dihydro-2H-chromen-4-yl)-3,5-dinitrobenzamide |
| SMILES | O=C(NC1CCOc2c(Cl)cccc21)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H12ClN3O6/c17-13-3-1-2-12-14(4-5-26-15(12)13)18-16(21)9-6-10(19(22)23)8-11(7-9)20(24)25/h1-3,6-8,14H,4-5H2,(H,18,21) |
| InChIKey | NUYXUVPTDBHRDS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.74 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|