About N-[(4S)-8-chloro-3,4-dihydro-2H-chromen-4-yl]-2-(methylamino)pyridine-4-carboxamide
N-[(4S)-8-chloro-3,4-dihydro-2H-chromen-4-yl]-2-(methylamino)pyridine-4-carboxamide (PubChem CID 124882769) has the molecular formula C16H16ClN3O2
and a molecular weight of 317.78 g/mol. Its IUPAC name is N-[(4S)-8-chloro-3,4-dihydro-2H-chromen-4-yl]-2-(methylamino)pyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-[(4S)-8-chloro-3,4-dihydro-2H-chromen-4-yl]-2-(methylamino)pyridine-4-carboxamide |
| PubChem CID | 124882769 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | N-[(4S)-8-chloro-3,4-dihydro-2H-chromen-4-yl]-2-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1cc(C(=O)N[C@H]2CCOc3c(Cl)cccc32)ccn1 |
| InChI | InChI=1S/C16H16ClN3O2/c1-18-14-9-10(5-7-19-14)16(21)20-13-6-8-22-15-11(13)3-2-4-12(15)17/h2-5,7,9,13H,6,8H2,1H3,(H,18,19)(H,20,21)/t13-/m0/s1 |
| InChIKey | BCCHDMSIDXRNEX-ZDUSSCGKSA-N |
| XLogP | 3.03 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(4S)-8-chloro-3,4-dihydro-2H-chromen-4-yl]-2-(methylamino)pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4S)-8-chloro-3,4-dihydro-2H-chromen-4-yl]-2-(methylamino)pyridine-4-carboxamide?
The IUPAC name of N-[(4S)-8-chloro-3,4-dihydro-2H-chromen-4-yl]-2-(methylamino)pyridine-4-carboxamide (CID 124882769) is N-[(4S)-8-chloro-3,4-dihydro-2H-chromen-4-yl]-2-(methylamino)pyridine-4-carboxamide.
What is the SMILES notation for N-[(4S)-8-chloro-3,4-dihydro-2H-chromen-4-yl]-2-(methylamino)pyridine-4-carboxamide?
The canonical SMILES for N-[(4S)-8-chloro-3,4-dihydro-2H-chromen-4-yl]-2-(methylamino)pyridine-4-carboxamide is CNc1cc(C(=O)N[C@H]2CCOc3c(Cl)cccc32)ccn1.
What is the InChIKey of N-[(4S)-8-chloro-3,4-dihydro-2H-chromen-4-yl]-2-(methylamino)pyridine-4-carboxamide?
The InChIKey is BCCHDMSIDXRNEX-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H16ClN3O2/c1-18-14-9-10(5-7-19-14)16(21)20-13-6-8-22-15-11(13)3-2-4-12(15)17/h2-5,7,9,13H,6,8H2,1H3,(H,18,19)(H,20,21)/t13-/m0/s1.
What are the key properties of N-[(4S)-8-chloro-3,4-dihydro-2H-chromen-4-yl]-2-(methylamino)pyridine-4-carboxamide?
N-[(4S)-8-chloro-3,4-dihydro-2H-chromen-4-yl]-2-(methylamino)pyridine-4-carboxamide has a molecular weight of 317.78 g/mol, XLogP of 3.03, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4S)-8-chloro-3,4-dihydro-2H-chromen-4-yl]-2-(methylamino)pyridine-4-carboxamide is sourced from PubChem (CID 124882769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).