C15H17Cl2NO3 — CID 99795973
N-[(4R)-7,8-dichloro-3,4-dihydro-2H-chromen-4-yl]oxane-4-carboxamide (PubChem CID 99795973) has the molecular formula C15H17Cl2NO3 and a molecular weight of 330.21 g/mol. Its IUPAC name is N-[(4R)-7,8-dichloro-3,4-dihydro-2H-chromen-4-yl]oxane-4-carboxamide.
| Compound Name | N-[(4R)-7,8-dichloro-3,4-dihydro-2H-chromen-4-yl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 99795973 |
| Molecular Formula | C15H17Cl2NO3 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | N-[(4R)-7,8-dichloro-3,4-dihydro-2H-chromen-4-yl]oxane-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCOc2c1ccc(Cl)c2Cl)C1CCOCC1 |
| InChI | InChI=1S/C15H17Cl2NO3/c16-11-2-1-10-12(5-8-21-14(10)13(11)17)18-15(19)9-3-6-20-7-4-9/h1-2,9,12H,3-8H2,(H,18,19)/t12-/m1/s1 |
| InChIKey | PJMDCAZHPQOGHG-GFCCVEGCSA-N |
| XLogP | 3.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |