C11H16ClN3O2S — CID 119427834
2-N-piperidin-3-ylthiophene-2,4-dicarboxamide;hydrochloride (PubChem CID 119427834) has the molecular formula C11H16ClN3O2S and a molecular weight of 289.79 g/mol. Its IUPAC name is 2-N-piperidin-3-ylthiophene-2,4-dicarboxamide;hydrochloride.
| Compound Name | 2-N-piperidin-3-ylthiophene-2,4-dicarboxamide;hydrochloride |
|---|---|
| PubChem CID | 119427834 |
| Molecular Formula | C11H16ClN3O2S |
| Molecular Weight | 289.79 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-N-piperidin-3-ylthiophene-2,4-dicarboxamide;hydrochloride |
| SMILES | Cl.NC(=O)c1csc(C(=O)NC2CCCNC2)c1 |
| InChI | InChI=1S/C11H15N3O2S.ClH/c12-10(15)7-4-9(17-6-7)11(16)14-8-2-1-3-13-5-8;/h4,6,8,13H,1-3,5H2,(H2,12,15)(H,14,16);1H |
| InChIKey | RVNVZVJLUITSON-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.79 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |