C12H18ClN3O2S — CID 119463278
2-N-(piperidin-3-ylmethyl)thiophene-2,4-dicarboxamide;hydrochloride (PubChem CID 119463278) has the molecular formula C12H18ClN3O2S and a molecular weight of 303.81 g/mol. Its IUPAC name is 2-N-(piperidin-3-ylmethyl)thiophene-2,4-dicarboxamide;hydrochloride.
| Compound Name | 2-N-(piperidin-3-ylmethyl)thiophene-2,4-dicarboxamide;hydrochloride |
|---|---|
| PubChem CID | 119463278 |
| Molecular Formula | C12H18ClN3O2S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 2-N-(piperidin-3-ylmethyl)thiophene-2,4-dicarboxamide;hydrochloride |
| SMILES | Cl.NC(=O)c1csc(C(=O)NCC2CCCNC2)c1 |
| InChI | InChI=1S/C12H17N3O2S.ClH/c13-11(16)9-4-10(18-7-9)12(17)15-6-8-2-1-3-14-5-8;/h4,7-8,14H,1-3,5-6H2,(H2,13,16)(H,15,17);1H |
| InChIKey | YNNKUIYCRVHVHQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |