C10H12Br2N2OS — CID 103866520
4,5-dibromo-N-[(3S)-piperidin-3-yl]thiophene-2-carboxamide (PubChem CID 103866520) has the molecular formula C10H12Br2N2OS and a molecular weight of 368.09 g/mol. Its IUPAC name is 4,5-dibromo-N-[(3S)-piperidin-3-yl]thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[(3S)-piperidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103866520 |
| Molecular Formula | C10H12Br2N2OS |
| Molecular Weight | 368.09 g/mol |
| Exact Mass | 365.90 |
| IUPAC Name | 4,5-dibromo-N-[(3S)-piperidin-3-yl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@H]1CCCNC1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H12Br2N2OS/c11-7-4-8(16-9(7)12)10(15)14-6-2-1-3-13-5-6/h4,6,13H,1-3,5H2,(H,14,15)/t6-/m0/s1 |
| InChIKey | DRHRJXMAEKTVBF-LURJTMIESA-N |
| XLogP | 2.75 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.09 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |