C10H12ClN3O3S — CID 112530952
5-chloro-4-nitro-N-piperidin-3-ylthiophene-2-carboxamide (PubChem CID 112530952) has the molecular formula C10H12ClN3O3S and a molecular weight of 289.74 g/mol. Its IUPAC name is 5-chloro-4-nitro-N-piperidin-3-ylthiophene-2-carboxamide.
| Compound Name | 5-chloro-4-nitro-N-piperidin-3-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 112530952 |
| Molecular Formula | C10H12ClN3O3S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 5-chloro-4-nitro-N-piperidin-3-ylthiophene-2-carboxamide |
| SMILES | O=C(NC1CCCNC1)c1cc([N+](=O)[O-])c(Cl)s1 |
| InChI | InChI=1S/C10H12ClN3O3S/c11-9-7(14(16)17)4-8(18-9)10(15)13-6-2-1-3-12-5-6/h4,6,12H,1-3,5H2,(H,13,15) |
| InChIKey | KQMFMLGIOYACBJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|