C10H14ClN3O3S — CID 119452265
5-methyl-4-nitro-N-pyrrolidin-3-ylthiophene-2-carboxamide;hydrochloride (PubChem CID 119452265) has the molecular formula C10H14ClN3O3S and a molecular weight of 291.76 g/mol. Its IUPAC name is 5-methyl-4-nitro-N-pyrrolidin-3-ylthiophene-2-carboxamide;hydrochloride.
| Compound Name | 5-methyl-4-nitro-N-pyrrolidin-3-ylthiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119452265 |
| Molecular Formula | C10H14ClN3O3S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 5-methyl-4-nitro-N-pyrrolidin-3-ylthiophene-2-carboxamide;hydrochloride |
| SMILES | Cc1sc(C(=O)NC2CCNC2)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C10H13N3O3S.ClH/c1-6-8(13(15)16)4-9(17-6)10(14)12-7-2-3-11-5-7;/h4,7,11H,2-3,5H2,1H3,(H,12,14);1H |
| InChIKey | QOYZDFPGTPEIAU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|