C15H18N2OS — CID 145194354
5-methyl-N-piperidin-3-yl-1-benzothiophene-2-carboxamide (PubChem CID 145194354) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 5-methyl-N-piperidin-3-yl-1-benzothiophene-2-carboxamide.
| Compound Name | 5-methyl-N-piperidin-3-yl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 145194354 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 5-methyl-N-piperidin-3-yl-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc2sc(C(=O)NC3CCCNC3)cc2c1 |
| InChI | InChI=1S/C15H18N2OS/c1-10-4-5-13-11(7-10)8-14(19-13)15(18)17-12-3-2-6-16-9-12/h4-5,7-8,12,16H,2-3,6,9H2,1H3,(H,17,18) |
| InChIKey | UPKBXIVFRMMXCJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |