C16H19N3O2 — CID 138024753
N-[(1S,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]-2,5-dimethyl-1H-imidazole-4-carboxamide (PubChem CID 138024753) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is N-[(1S,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]-2,5-dimethyl-1H-imidazole-4-carboxamide.
| Compound Name | N-[(1S,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]-2,5-dimethyl-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 138024753 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-[(1S,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]-2,5-dimethyl-1H-imidazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)N[C@H]2c3ccccc3CC[C@H]2O)c(C)[nH]1 |
| InChI | InChI=1S/C16H19N3O2/c1-9-14(18-10(2)17-9)16(21)19-15-12-6-4-3-5-11(12)7-8-13(15)20/h3-6,13,15,20H,7-8H2,1-2H3,(H,17,18)(H,19,21)/t13-,15+/m1/s1 |
| InChIKey | FLHGQUCASHHPAW-HIFRSBDPSA-N |
| XLogP | 1.80 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |