C15H17N3O3 — CID 138025616
1-[(1S,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(3-methyl-1,2-oxazol-4-yl)urea (PubChem CID 138025616) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 1-[(1S,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(3-methyl-1,2-oxazol-4-yl)urea.
| Compound Name | 1-[(1S,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(3-methyl-1,2-oxazol-4-yl)urea |
|---|---|
| PubChem CID | 138025616 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-[(1S,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(3-methyl-1,2-oxazol-4-yl)urea |
| SMILES | Cc1nocc1NC(=O)N[C@H]1c2ccccc2CC[C@H]1O |
| InChI | InChI=1S/C15H17N3O3/c1-9-12(8-21-18-9)16-15(20)17-14-11-5-3-2-4-10(11)6-7-13(14)19/h2-5,8,13-14,19H,6-7H2,1H3,(H2,16,17,20)/t13-,14+/m1/s1 |
| InChIKey | ZSIUYJUFQVOWJA-KGLIPLIRSA-N |
| XLogP | 2.15 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |