C22H24N4O — CID 96542591
1-(2,3-dimethylphenyl)-3-[(1R,2S)-2-imidazol-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]urea (PubChem CID 96542591) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[(1R,2S)-2-imidazol-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]urea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[(1R,2S)-2-imidazol-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]urea |
|---|---|
| PubChem CID | 96542591 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[(1R,2S)-2-imidazol-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]urea |
| SMILES | Cc1cccc(NC(=O)N[C@@H]2c3ccccc3CC[C@@H]2n2ccnc2)c1C |
| InChI | InChI=1S/C22H24N4O/c1-15-6-5-9-19(16(15)2)24-22(27)25-21-18-8-4-3-7-17(18)10-11-20(21)26-13-12-23-14-26/h3-9,12-14,20-21H,10-11H2,1-2H3,(H2,24,25,27)/t20-,21+/m0/s1 |
| InChIKey | VPBZYFHOLLYAKS-LEWJYISDSA-N |
| XLogP | 4.55 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |