C22H20N6OS — CID 96538310
1-[(1S,2R)-2-imidazol-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(4-pyridin-3-yl-1,3-thiazol-2-yl)urea (PubChem CID 96538310) has the molecular formula C22H20N6OS and a molecular weight of 416.51 g/mol. Its IUPAC name is 1-[(1S,2R)-2-imidazol-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(4-pyridin-3-yl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-[(1S,2R)-2-imidazol-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(4-pyridin-3-yl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 96538310 |
| Molecular Formula | C22H20N6OS |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 1-[(1S,2R)-2-imidazol-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(4-pyridin-3-yl-1,3-thiazol-2-yl)urea |
| SMILES | O=C(Nc1nc(-c2cccnc2)cs1)N[C@H]1c2ccccc2CC[C@H]1n1ccnc1 |
| InChI | InChI=1S/C22H20N6OS/c29-21(27-22-25-18(13-30-22)16-5-3-9-23-12-16)26-20-17-6-2-1-4-15(17)7-8-19(20)28-11-10-24-14-28/h1-6,9-14,19-20H,7-8H2,(H2,25,26,27,29)/t19-,20+/m1/s1 |
| InChIKey | VNGXXIGUIIFONF-UXHICEINSA-N |
| XLogP | 4.45 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |