C19H24N4O — CID 146100955
(E)-4-(dimethylamino)-N-(2-imidazol-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl)but-2-enamide (PubChem CID 146100955) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-(2-imidazol-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl)but-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-(2-imidazol-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl)but-2-enamide |
|---|---|
| PubChem CID | 146100955 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | (E)-4-(dimethylamino)-N-(2-imidazol-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)NC1c2ccccc2CCC1n1ccnc1 |
| InChI | InChI=1S/C19H24N4O/c1-22(2)12-5-8-18(24)21-19-16-7-4-3-6-15(16)9-10-17(19)23-13-11-20-14-23/h3-8,11,13-14,17,19H,9-10,12H2,1-2H3,(H,21,24)/b8-5+ |
| InChIKey | VMCHCZDRONCQKA-VMPITWQZSA-N |
| XLogP | 2.35 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|