C13H15N3 — CID 28793311
(1R,2S)-2-imidazol-1-yl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 28793311) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is (1R,2S)-2-imidazol-1-yl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1R,2S)-2-imidazol-1-yl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 28793311 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | (1R,2S)-2-imidazol-1-yl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | N[C@@H]1c2ccccc2CC[C@@H]1n1ccnc1 |
| InChI | InChI=1S/C13H15N3/c14-13-11-4-2-1-3-10(11)5-6-12(13)16-8-7-15-9-16/h1-4,7-9,12-13H,5-6,14H2/t12-,13+/m0/s1 |
| InChIKey | XURCCJOGZFFRKU-QWHCGFSZSA-N |
| XLogP | 2.07 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |