C19H25NOS — CID 51852817
N-[(1R)-1-(4-tert-butylphenyl)ethyl]-5-ethylthiophene-3-carboxamide (PubChem CID 51852817) has the molecular formula C19H25NOS and a molecular weight of 315.48 g/mol. Its IUPAC name is N-[(1R)-1-(4-tert-butylphenyl)ethyl]-5-ethylthiophene-3-carboxamide.
| Compound Name | N-[(1R)-1-(4-tert-butylphenyl)ethyl]-5-ethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 51852817 |
| Molecular Formula | C19H25NOS |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | N-[(1R)-1-(4-tert-butylphenyl)ethyl]-5-ethylthiophene-3-carboxamide |
| SMILES | CCc1cc(C(=O)N[C@H](C)c2ccc(C(C)(C)C)cc2)cs1 |
| InChI | InChI=1S/C19H25NOS/c1-6-17-11-15(12-22-17)18(21)20-13(2)14-7-9-16(10-8-14)19(3,4)5/h7-13H,6H2,1-5H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | HVIIPPHHPQMCGS-CYBMUJFWSA-N |
| XLogP | 5.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |