C11H14N4O5S — CID 174056511
[1-[4-(N'-acetyloxycarbamimidoyl)thiophen-2-yl]-2-(methylamino)-2-oxoethyl]carbamic acid (PubChem CID 174056511) has the molecular formula C11H14N4O5S and a molecular weight of 314.32 g/mol. Its IUPAC name is [1-[4-(N'-acetyloxycarbamimidoyl)thiophen-2-yl]-2-(methylamino)-2-oxoethyl]carbamic acid.
| Compound Name | [1-[4-(N'-acetyloxycarbamimidoyl)thiophen-2-yl]-2-(methylamino)-2-oxoethyl]carbamic acid |
|---|---|
| PubChem CID | 174056511 |
| Molecular Formula | C11H14N4O5S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | [1-[4-(N'-acetyloxycarbamimidoyl)thiophen-2-yl]-2-(methylamino)-2-oxoethyl]carbamic acid |
| SMILES | CNC(=O)C(NC(=O)O)c1cc(C(N)=NOC(C)=O)cs1 |
| InChI | InChI=1S/C11H14N4O5S/c1-5(16)20-15-9(12)6-3-7(21-4-6)8(10(17)13-2)14-11(18)19/h3-4,8,14H,1-2H3,(H2,12,15)(H,13,17)(H,18,19) |
| InChIKey | FUGPAEHIIOCMCF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|