C32H35N5O7S — CID 163225265
[(Z)-[amino-[5-[(1R)-1-[[(8S)-7-[2-[[3-(4-methylphenyl)benzoyl]amino]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carbonyl]amino]ethyl]thiophen-3-yl]methylidene]amino] acetate (PubChem CID 163225265) has the molecular formula C32H35N5O7S and a molecular weight of 633.73 g/mol. Its IUPAC name is [(Z)-[amino-[5-[(1R)-1-[[(8S)-7-[2-[[3-(4-methylphenyl)benzoyl]amino]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carbonyl]amino]ethyl]thiophen-3-yl]methylidene]amino] acetate.
| Compound Name | [(Z)-[amino-[5-[(1R)-1-[[(8S)-7-[2-[[3-(4-methylphenyl)benzoyl]amino]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carbonyl]amino]ethyl]thiophen-3-yl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 163225265 |
| Molecular Formula | C32H35N5O7S |
| Molecular Weight | 633.73 g/mol |
| Exact Mass | 633.23 |
| IUPAC Name | [(Z)-[amino-[5-[(1R)-1-[[(8S)-7-[2-[[3-(4-methylphenyl)benzoyl]amino]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carbonyl]amino]ethyl]thiophen-3-yl]methylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\N)c1csc([C@@H](C)NC(=O)[C@@H]2CC3(CN2C(=O)CNC(=O)c2cccc(-c4ccc(C)cc4)c2)OCCO3)c1 |
| InChI | InChI=1S/C32H35N5O7S/c1-19-7-9-22(10-8-19)23-5-4-6-24(13-23)30(40)34-16-28(39)37-18-32(42-11-12-43-32)15-26(37)31(41)35-20(2)27-14-25(17-45-27)29(33)36-44-21(3)38/h4-10,13-14,17,20,26H,11-12,15-16,18H2,1-3H3,(H2,33,36)(H,34,40)(H,35,41)/t20-,26+/m1/s1 |
| InChIKey | MLIWWGZPNFGUTJ-IBVKSMDESA-N |
| XLogP | 2.86 |
| TPSA | 161.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.73 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|