C33H33N5O7S — CID 169199338
[(Z)-[amino-[5-[(1R)-1-[[(8S)-7-[2-(anthracene-2-carbonylamino)acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carbonyl]amino]ethyl]thiophen-3-yl]methylidene]amino] acetate (PubChem CID 169199338) has the molecular formula C33H33N5O7S and a molecular weight of 643.72 g/mol. Its IUPAC name is [(Z)-[amino-[5-[(1R)-1-[[(8S)-7-[2-(anthracene-2-carbonylamino)acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carbonyl]amino]ethyl]thiophen-3-yl]methylidene]amino] acetate.
| Compound Name | [(Z)-[amino-[5-[(1R)-1-[[(8S)-7-[2-(anthracene-2-carbonylamino)acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carbonyl]amino]ethyl]thiophen-3-yl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 169199338 |
| Molecular Formula | C33H33N5O7S |
| Molecular Weight | 643.72 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | [(Z)-[amino-[5-[(1R)-1-[[(8S)-7-[2-(anthracene-2-carbonylamino)acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carbonyl]amino]ethyl]thiophen-3-yl]methylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\N)c1csc([C@@H](C)NC(=O)[C@@H]2CC3(CN2C(=O)CNC(=O)c2ccc4cc5ccccc5cc4c2)OCCO3)c1 |
| InChI | InChI=1S/C33H33N5O7S/c1-19(28-14-26(17-46-28)30(34)37-45-20(2)39)36-32(42)27-15-33(43-9-10-44-33)18-38(27)29(40)16-35-31(41)24-8-7-23-11-21-5-3-4-6-22(21)12-25(23)13-24/h3-8,11-14,17,19,27H,9-10,15-16,18H2,1-2H3,(H2,34,37)(H,35,41)(H,36,42)/t19-,27+/m1/s1 |
| InChIKey | PMSJOIFRURYVLC-WINIVTDRSA-N |
| XLogP | 3.19 |
| TPSA | 161.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.72 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|