C31H31N5O5S — CID 170165044
7-[2-(anthracene-2-carbonylamino)acetyl]-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide (PubChem CID 170165044) has the molecular formula C31H31N5O5S and a molecular weight of 585.69 g/mol. Its IUPAC name is 7-[2-(anthracene-2-carbonylamino)acetyl]-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide.
| Compound Name | 7-[2-(anthracene-2-carbonylamino)acetyl]-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide |
|---|---|
| PubChem CID | 170165044 |
| Molecular Formula | C31H31N5O5S |
| Molecular Weight | 585.69 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | 7-[2-(anthracene-2-carbonylamino)acetyl]-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide |
| SMILES | [H]/N=C(\N)c1csc([C@@H](C)NC(=O)C2CC3(CN2C(=O)CNC(=O)c2ccc4cc5ccccc5cc4c2)OCCO3)c1 |
| InChI | InChI=1S/C31H31N5O5S/c1-18(26-13-24(16-42-26)28(32)33)35-30(39)25-14-31(40-8-9-41-31)17-36(25)27(37)15-34-29(38)22-7-6-21-10-19-4-2-3-5-20(19)11-23(21)12-22/h2-7,10-13,16,18,25H,8-9,14-15,17H2,1H3,(H3,32,33)(H,34,38)(H,35,39)/t18-,25?/m1/s1 |
| InChIKey | OHOQNYLHRAUJSU-YDONVPIESA-N |
| XLogP | 3.29 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.69 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|