C29H30N6O6S — CID 170164703
N-[2-[8-[[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]carbamoyl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]-2-oxoethyl]-10H-phenoxazine-3-carboxamide (PubChem CID 170164703) has the molecular formula C29H30N6O6S and a molecular weight of 590.66 g/mol. Its IUPAC name is N-[2-[8-[[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]carbamoyl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]-2-oxoethyl]-10H-phenoxazine-3-carboxamide.
| Compound Name | N-[2-[8-[[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]carbamoyl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]-2-oxoethyl]-10H-phenoxazine-3-carboxamide |
|---|---|
| PubChem CID | 170164703 |
| Molecular Formula | C29H30N6O6S |
| Molecular Weight | 590.66 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | N-[2-[8-[[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]carbamoyl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]-2-oxoethyl]-10H-phenoxazine-3-carboxamide |
| SMILES | [H]/N=C(\N)c1csc([C@@H](C)NC(=O)C2CC3(CN2C(=O)CNC(=O)c2ccc4c(c2)Oc2ccccc2N4)OCCO3)c1 |
| InChI | InChI=1S/C29H30N6O6S/c1-16(24-11-18(14-42-24)26(30)31)33-28(38)21-12-29(39-8-9-40-29)15-35(21)25(36)13-32-27(37)17-6-7-20-23(10-17)41-22-5-3-2-4-19(22)34-20/h2-7,10-11,14,16,21,34H,8-9,12-13,15H2,1H3,(H3,30,31)(H,32,37)(H,33,38)/t16-,21?/m1/s1 |
| InChIKey | OTZORHPYXWJKLZ-UJONTBEJSA-N |
| XLogP | 2.83 |
| TPSA | 168.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.66 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|