C30H32FN5O5S — CID 163225416
(2S,4R)-1-[2-[(4-benzoylbenzoyl)amino]acetyl]-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-4-fluoro-4-(methoxymethyl)pyrrolidine-2-carboxamide (PubChem CID 163225416) has the molecular formula C30H32FN5O5S and a molecular weight of 593.68 g/mol. Its IUPAC name is (2S,4R)-1-[2-[(4-benzoylbenzoyl)amino]acetyl]-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-4-fluoro-4-(methoxymethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[2-[(4-benzoylbenzoyl)amino]acetyl]-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-4-fluoro-4-(methoxymethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163225416 |
| Molecular Formula | C30H32FN5O5S |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | (2S,4R)-1-[2-[(4-benzoylbenzoyl)amino]acetyl]-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-4-fluoro-4-(methoxymethyl)pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc([C@@H](C)NC(=O)[C@@H]2C[C@](F)(COC)CN2C(=O)CNC(=O)c2ccc(C(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C30H32FN5O5S/c1-18(24-12-22(15-42-24)27(32)33)35-29(40)23-13-30(31,17-41-2)16-36(23)25(37)14-34-28(39)21-10-8-20(9-11-21)26(38)19-6-4-3-5-7-19/h3-12,15,18,23H,13-14,16-17H2,1-2H3,(H3,32,33)(H,34,39)(H,35,40)/t18-,23+,30-/m1/s1 |
| InChIKey | BBDRIALFVPFUBZ-XXKRRWLPSA-N |
| XLogP | 2.83 |
| TPSA | 154.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|