C31H30F5N5O3S — CID 170300458
(2S,4R)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-methyl-4-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide (PubChem CID 170300458) has the molecular formula C31H30F5N5O3S and a molecular weight of 647.67 g/mol. Its IUPAC name is (2S,4R)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-methyl-4-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-methyl-4-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 170300458 |
| Molecular Formula | C31H30F5N5O3S |
| Molecular Weight | 647.67 g/mol |
| Exact Mass | 647.20 |
| IUPAC Name | (2S,4R)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-methyl-4-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc([C@@H](C)NC(=O)[C@@H]2C[C@](C)(CC(F)(F)F)CN2C(=O)CNC(=O)c2ccc3c(c2)-c2ccccc2C3(F)F)c1 |
| InChI | InChI=1S/C31H30F5N5O3S/c1-16(24-10-18(13-45-24)26(37)38)40-28(44)23-11-29(2,14-30(32,33)34)15-41(23)25(42)12-39-27(43)17-7-8-22-20(9-17)19-5-3-4-6-21(19)31(22,35)36/h3-10,13,16,23H,11-12,14-15H2,1-2H3,(H3,37,38)(H,39,43)(H,40,44)/t16-,23+,29-/m1/s1 |
| InChIKey | FBWBEGJAEIYOLM-PKQNDKPUSA-N |
| XLogP | 5.32 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.67 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|