C34H31F2N5O4S — CID 169197987
(2S,4R)-N-[(1S)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-phenoxypyrrolidine-2-carboxamide (PubChem CID 169197987) has the molecular formula C34H31F2N5O4S and a molecular weight of 643.72 g/mol. Its IUPAC name is (2S,4R)-N-[(1S)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-phenoxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[(1S)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-phenoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 169197987 |
| Molecular Formula | C34H31F2N5O4S |
| Molecular Weight | 643.72 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | (2S,4R)-N-[(1S)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-phenoxypyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc([C@H](C)NC(=O)[C@@H]2C[C@@H](Oc3ccccc3)CN2C(=O)CNC(=O)c2ccc3c(c2)-c2ccccc2C3(F)F)c1 |
| InChI | InChI=1S/C34H31F2N5O4S/c1-19(29-14-21(18-46-29)31(37)38)40-33(44)28-15-23(45-22-7-3-2-4-8-22)17-41(28)30(42)16-39-32(43)20-11-12-27-25(13-20)24-9-5-6-10-26(24)34(27,35)36/h2-14,18-19,23,28H,15-17H2,1H3,(H3,37,38)(H,39,43)(H,40,44)/t19-,23+,28-/m0/s1 |
| InChIKey | WBXBDNZFOPSJKA-KPJDJKPDSA-N |
| XLogP | 4.81 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.72 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|