C30H31F2N5O4S — CID 169199235
N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-2-carbonyl)amino]acetyl]-4-(methoxymethyl)pyrrolidine-2-carboxamide (PubChem CID 169199235) has the molecular formula C30H31F2N5O4S and a molecular weight of 595.67 g/mol. Its IUPAC name is N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-2-carbonyl)amino]acetyl]-4-(methoxymethyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-2-carbonyl)amino]acetyl]-4-(methoxymethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 169199235 |
| Molecular Formula | C30H31F2N5O4S |
| Molecular Weight | 595.67 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-2-carbonyl)amino]acetyl]-4-(methoxymethyl)pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc([C@@H](C)NC(=O)C2CC(COC)CN2C(=O)CNC(=O)c2ccc3c(c2)C(F)(F)c2ccccc2-3)c1 |
| InChI | InChI=1S/C30H31F2N5O4S/c1-16(25-11-19(15-42-25)27(33)34)36-29(40)24-9-17(14-41-2)13-37(24)26(38)12-35-28(39)18-7-8-21-20-5-3-4-6-22(20)30(31,32)23(21)10-18/h3-8,10-11,15-17,24H,9,12-14H2,1-2H3,(H3,33,34)(H,35,39)(H,36,40)/t16-,17?,24?/m1/s1 |
| InChIKey | QXKRWYWMSVJWRU-DQNLNSHTSA-N |
| XLogP | 3.62 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.67 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|