C29H29F2N5O3S — CID 170293163
N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-methylpyrrolidine-2-carboxamide (PubChem CID 170293163) has the molecular formula C29H29F2N5O3S and a molecular weight of 565.65 g/mol. Its IUPAC name is N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-methylpyrrolidine-2-carboxamide.
| Compound Name | N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 170293163 |
| Molecular Formula | C29H29F2N5O3S |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-methylpyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc([C@@H](C)NC(=O)C2CC(C)CN2C(=O)CNC(=O)c2ccc3c(c2)-c2ccccc2C3(F)F)c1 |
| InChI | InChI=1S/C29H29F2N5O3S/c1-15-9-23(28(39)35-16(2)24-11-18(14-40-24)26(32)33)36(13-15)25(37)12-34-27(38)17-7-8-22-20(10-17)19-5-3-4-6-21(19)29(22,30)31/h3-8,10-11,14-16,23H,9,12-13H2,1-2H3,(H3,32,33)(H,34,38)(H,35,39)/t15?,16-,23?/m1/s1 |
| InChIKey | JUTCFVZBIJLMAW-IOXSGPKDSA-N |
| XLogP | 4.00 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|