C31H35N5O5S2 — CID 169197956
(2S,4R)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-dimethylfluorene-3-carbonyl)amino]acetyl]-4-methylsulfonylpyrrolidine-2-carboxamide (PubChem CID 169197956) has the molecular formula C31H35N5O5S2 and a molecular weight of 621.79 g/mol. Its IUPAC name is (2S,4R)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-dimethylfluorene-3-carbonyl)amino]acetyl]-4-methylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-dimethylfluorene-3-carbonyl)amino]acetyl]-4-methylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 169197956 |
| Molecular Formula | C31H35N5O5S2 |
| Molecular Weight | 621.79 g/mol |
| Exact Mass | 621.21 |
| IUPAC Name | (2S,4R)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-dimethylfluorene-3-carbonyl)amino]acetyl]-4-methylsulfonylpyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc([C@@H](C)NC(=O)[C@@H]2C[C@@H](S(C)(=O)=O)CN2C(=O)CNC(=O)c2ccc3c(c2)-c2ccccc2C3(C)C)c1 |
| InChI | InChI=1S/C31H35N5O5S2/c1-17(26-12-19(16-42-26)28(32)33)35-30(39)25-13-20(43(4,40)41)15-36(25)27(37)14-34-29(38)18-9-10-24-22(11-18)21-7-5-6-8-23(21)31(24,2)3/h5-12,16-17,20,25H,13-15H2,1-4H3,(H3,32,33)(H,34,38)(H,35,39)/t17-,20-,25+/m1/s1 |
| InChIKey | MUDXTOXUZAZXMR-CVBYOTHMSA-N |
| XLogP | 2.96 |
| TPSA | 162.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.79 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|