C32H37N5O4S — CID 169199012
N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-dimethylfluorene-3-carbonyl)amino]acetyl]-4-(methoxymethyl)pyrrolidine-2-carboxamide (PubChem CID 169199012) has the molecular formula C32H37N5O4S and a molecular weight of 587.75 g/mol. Its IUPAC name is N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-dimethylfluorene-3-carbonyl)amino]acetyl]-4-(methoxymethyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-dimethylfluorene-3-carbonyl)amino]acetyl]-4-(methoxymethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 169199012 |
| Molecular Formula | C32H37N5O4S |
| Molecular Weight | 587.75 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-dimethylfluorene-3-carbonyl)amino]acetyl]-4-(methoxymethyl)pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc([C@@H](C)NC(=O)C2CC(COC)CN2C(=O)CNC(=O)c2ccc3c(c2)-c2ccccc2C3(C)C)c1 |
| InChI | InChI=1S/C32H37N5O4S/c1-18(27-13-21(17-42-27)29(33)34)36-31(40)26-11-19(16-41-4)15-37(26)28(38)14-35-30(39)20-9-10-25-23(12-20)22-7-5-6-8-24(22)32(25,2)3/h5-10,12-13,17-19,26H,11,14-16H2,1-4H3,(H3,33,34)(H,35,39)(H,36,40)/t18-,19?,26?/m1/s1 |
| InChIKey | UITBTZCAHYTBDV-GDZHNBNXSA-N |
| XLogP | 3.81 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.75 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|