C28H29N5O4S — CID 169199120
(2S,4S)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-(dibenzofuran-2-carbonylamino)acetyl]-4-methylpyrrolidine-2-carboxamide (PubChem CID 169199120) has the molecular formula C28H29N5O4S and a molecular weight of 531.64 g/mol. Its IUPAC name is (2S,4S)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-(dibenzofuran-2-carbonylamino)acetyl]-4-methylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-(dibenzofuran-2-carbonylamino)acetyl]-4-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 169199120 |
| Molecular Formula | C28H29N5O4S |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | (2S,4S)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-(dibenzofuran-2-carbonylamino)acetyl]-4-methylpyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc([C@@H](C)NC(=O)[C@@H]2C[C@H](C)CN2C(=O)CNC(=O)c2ccc3oc4ccccc4c3c2)c1 |
| InChI | InChI=1S/C28H29N5O4S/c1-15-9-21(28(36)32-16(2)24-11-18(14-38-24)26(29)30)33(13-15)25(34)12-31-27(35)17-7-8-23-20(10-17)19-5-3-4-6-22(19)37-23/h3-8,10-11,14-16,21H,9,12-13H2,1-2H3,(H3,29,30)(H,31,35)(H,32,36)/t15-,16+,21-/m0/s1 |
| InChIKey | OIWUTWGXMPDSKW-MRUHUIDDSA-N |
| XLogP | 3.78 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|