C33H39N5O4S — CID 163225295
(2S,4R)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-4-cyclohexyl-1-[2-[(4-phenoxybenzoyl)amino]acetyl]pyrrolidine-2-carboxamide (PubChem CID 163225295) has the molecular formula C33H39N5O4S and a molecular weight of 601.77 g/mol. Its IUPAC name is (2S,4R)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-4-cyclohexyl-1-[2-[(4-phenoxybenzoyl)amino]acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-4-cyclohexyl-1-[2-[(4-phenoxybenzoyl)amino]acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163225295 |
| Molecular Formula | C33H39N5O4S |
| Molecular Weight | 601.77 g/mol |
| Exact Mass | 601.27 |
| IUPAC Name | (2S,4R)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-4-cyclohexyl-1-[2-[(4-phenoxybenzoyl)amino]acetyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc([C@@H](C)NC(=O)[C@@H]2C[C@H](C3CCCCC3)CN2C(=O)CNC(=O)c2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C33H39N5O4S/c1-21(29-17-25(20-43-29)31(34)35)37-33(41)28-16-24(22-8-4-2-5-9-22)19-38(28)30(39)18-36-32(40)23-12-14-27(15-13-23)42-26-10-6-3-7-11-26/h3,6-7,10-15,17,20-22,24,28H,2,4-5,8-9,16,18-19H2,1H3,(H3,34,35)(H,36,40)(H,37,41)/t21-,24+,28+/m1/s1 |
| InChIKey | IGXFBKNERRZTAC-NZRVCZAQSA-N |
| XLogP | 5.23 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.77 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|