C31H34FN5O6S — CID 170164303
(2S,4S)-N-[1-(4-carbamimidoylthiophen-2-yl)ethyl]-4-(1,3-dioxan-2-yl)-1-[2-[[4-(4-fluorophenoxy)benzoyl]amino]acetyl]pyrrolidine-2-carboxamide (PubChem CID 170164303) has the molecular formula C31H34FN5O6S and a molecular weight of 623.71 g/mol. Its IUPAC name is (2S,4S)-N-[1-(4-carbamimidoylthiophen-2-yl)ethyl]-4-(1,3-dioxan-2-yl)-1-[2-[[4-(4-fluorophenoxy)benzoyl]amino]acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-N-[1-(4-carbamimidoylthiophen-2-yl)ethyl]-4-(1,3-dioxan-2-yl)-1-[2-[[4-(4-fluorophenoxy)benzoyl]amino]acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 170164303 |
| Molecular Formula | C31H34FN5O6S |
| Molecular Weight | 623.71 g/mol |
| Exact Mass | 623.22 |
| IUPAC Name | (2S,4S)-N-[1-(4-carbamimidoylthiophen-2-yl)ethyl]-4-(1,3-dioxan-2-yl)-1-[2-[[4-(4-fluorophenoxy)benzoyl]amino]acetyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc(C(C)NC(=O)[C@@H]2C[C@H](C3OCCCO3)CN2C(=O)CNC(=O)c2ccc(Oc3ccc(F)cc3)cc2)c1 |
| InChI | InChI=1S/C31H34FN5O6S/c1-18(26-14-21(17-44-26)28(33)34)36-30(40)25-13-20(31-41-11-2-12-42-31)16-37(25)27(38)15-35-29(39)19-3-7-23(8-4-19)43-24-9-5-22(32)6-10-24/h3-10,14,17-18,20,25,31H,2,11-13,15-16H2,1H3,(H3,33,34)(H,35,39)(H,36,40)/t18?,20-,25-/m0/s1 |
| InChIKey | DYUXPTVPACQLMM-ZGCXKRIGSA-N |
| XLogP | 3.55 |
| TPSA | 156.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.71 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|