C30H31N5O6S — CID 163226127
(8S)-7-[2-[(4-benzoylbenzoyl)amino]acetyl]-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide (PubChem CID 163226127) has the molecular formula C30H31N5O6S and a molecular weight of 589.67 g/mol. Its IUPAC name is (8S)-7-[2-[(4-benzoylbenzoyl)amino]acetyl]-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide.
| Compound Name | (8S)-7-[2-[(4-benzoylbenzoyl)amino]acetyl]-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide |
|---|---|
| PubChem CID | 163226127 |
| Molecular Formula | C30H31N5O6S |
| Molecular Weight | 589.67 g/mol |
| Exact Mass | 589.20 |
| IUPAC Name | (8S)-7-[2-[(4-benzoylbenzoyl)amino]acetyl]-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide |
| SMILES | [H]/N=C(\N)c1csc([C@@H](C)NC(=O)[C@@H]2CC3(CN2C(=O)CNC(=O)c2ccc(C(=O)c4ccccc4)cc2)OCCO3)c1 |
| InChI | InChI=1S/C30H31N5O6S/c1-18(24-13-22(16-42-24)27(31)32)34-29(39)23-14-30(40-11-12-41-30)17-35(23)25(36)15-33-28(38)21-9-7-20(8-10-21)26(37)19-5-3-2-4-6-19/h2-10,13,16,18,23H,11-12,14-15,17H2,1H3,(H3,31,32)(H,33,38)(H,34,39)/t18-,23+/m1/s1 |
| InChIKey | BYUSULKYZJVJOS-JPYJTQIMSA-N |
| XLogP | 2.21 |
| TPSA | 163.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.67 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|