C31H35N5O5S — CID 170165882
N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-7-[2-[[4-(2,4-dimethylphenyl)benzoyl]amino]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide (PubChem CID 170165882) has the molecular formula C31H35N5O5S and a molecular weight of 589.72 g/mol. Its IUPAC name is N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-7-[2-[[4-(2,4-dimethylphenyl)benzoyl]amino]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide.
| Compound Name | N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-7-[2-[[4-(2,4-dimethylphenyl)benzoyl]amino]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide |
|---|---|
| PubChem CID | 170165882 |
| Molecular Formula | C31H35N5O5S |
| Molecular Weight | 589.72 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-7-[2-[[4-(2,4-dimethylphenyl)benzoyl]amino]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide |
| SMILES | [H]/N=C(\N)c1csc([C@@H](C)NC(=O)C2CC3(CN2C(=O)CNC(=O)c2ccc(-c4ccc(C)cc4C)cc2)OCCO3)c1 |
| InChI | InChI=1S/C31H35N5O5S/c1-18-4-9-24(19(2)12-18)21-5-7-22(8-6-21)29(38)34-15-27(37)36-17-31(40-10-11-41-31)14-25(36)30(39)35-20(3)26-13-23(16-42-26)28(32)33/h4-9,12-13,16,20,25H,10-11,14-15,17H2,1-3H3,(H3,32,33)(H,34,38)(H,35,39)/t20-,25?/m1/s1 |
| InChIKey | GNTYEQTWJXAQDA-VGOKPJQXSA-N |
| XLogP | 3.27 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.72 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|