C24H22N2O6 — CID 169198633
(8S)-7-[2-(anthracene-2-carbonylamino)acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylic acid (PubChem CID 169198633) has the molecular formula C24H22N2O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is (8S)-7-[2-(anthracene-2-carbonylamino)acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylic acid.
| Compound Name | (8S)-7-[2-(anthracene-2-carbonylamino)acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylic acid |
|---|---|
| PubChem CID | 169198633 |
| Molecular Formula | C24H22N2O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (8S)-7-[2-(anthracene-2-carbonylamino)acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylic acid |
| SMILES | O=C(NCC(=O)N1CC2(C[C@H]1C(=O)O)OCCO2)c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C24H22N2O6/c27-21(26-14-24(31-7-8-32-24)12-20(26)23(29)30)13-25-22(28)18-6-5-17-9-15-3-1-2-4-16(15)10-19(17)11-18/h1-6,9-11,20H,7-8,12-14H2,(H,25,28)(H,29,30)/t20-/m0/s1 |
| InChIKey | KVIFFFXLGDFWGA-FQEVSTJZSA-N |
| XLogP | 2.15 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|