C19H23FN2O7 — CID 163225779
(8S)-7-[2-[4-(4-fluorophenoxy)butanoylamino]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylic acid (PubChem CID 163225779) has the molecular formula C19H23FN2O7 and a molecular weight of 410.40 g/mol. Its IUPAC name is (8S)-7-[2-[4-(4-fluorophenoxy)butanoylamino]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylic acid.
| Compound Name | (8S)-7-[2-[4-(4-fluorophenoxy)butanoylamino]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylic acid |
|---|---|
| PubChem CID | 163225779 |
| Molecular Formula | C19H23FN2O7 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (8S)-7-[2-[4-(4-fluorophenoxy)butanoylamino]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylic acid |
| SMILES | O=C(CCCOc1ccc(F)cc1)NCC(=O)N1CC2(C[C@H]1C(=O)O)OCCO2 |
| InChI | InChI=1S/C19H23FN2O7/c20-13-3-5-14(6-4-13)27-7-1-2-16(23)21-11-17(24)22-12-19(28-8-9-29-19)10-15(22)18(25)26/h3-6,15H,1-2,7-12H2,(H,21,23)(H,25,26)/t15-/m0/s1 |
| InChIKey | PMKFVOLHJBWMDL-HNNXBMFYSA-N |
| XLogP | 0.53 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|