C18H22FN5O5 — CID 175438748
4-(azidomethyl)-4-fluoro-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxylic acid (PubChem CID 175438748) has the molecular formula C18H22FN5O5 and a molecular weight of 407.40 g/mol. Its IUPAC name is 4-(azidomethyl)-4-fluoro-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 4-(azidomethyl)-4-fluoro-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175438748 |
| Molecular Formula | C18H22FN5O5 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 4-(azidomethyl)-4-fluoro-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxylic acid |
| SMILES | [N-]=[N+]=NCC1(F)CC(C(=O)O)N(C(=O)CNC(=O)CCCOc2ccccc2)C1 |
| InChI | InChI=1S/C18H22FN5O5/c19-18(11-22-23-20)9-14(17(27)28)24(12-18)16(26)10-21-15(25)7-4-8-29-13-5-2-1-3-6-13/h1-3,5-6,14H,4,7-12H2,(H,21,25)(H,27,28) |
| InChIKey | VUBCBKOGDCFVQQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 144.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|